Pigment yellow 65 – Corimax Yellow RN
Technical parameters of Pigment yellow 65
| Číslo indexu barev | Pigmentová žlutá 65 |
| Jméno výrobku | Corimax Yellow RN |
| Kategorie produktů | Organické pigmenty |
| Číslo CAS | 6528-34-3 |
| Číslo EU | 229-419-9 |
| Chemická rodina | Monazo |
| Molekulární váha | 386.36 |
| Molekulární vzorec | C18H18N4O6 |
| Hodnota PH | 6.0-7.0 |
| Hustota | 1.6 |
| Absorpce oleje (ml / 100 g)% | 35-45 |
| Stálost světla (povlak) | 7 |
| Tepelná odolnost (povlak) | 140 |
| Voděodolnost | 5 |
| Odolnost proti olejům | 3 |
| Odolnost vůči kyselinám | 5 |
| Alkalická odolnost | 5 |
Barva | ![]() |
| Distribuce odstínů |
Funkce: Good dispersion.
Aplikace:
Recommended for architectural coatings, industrial coatings.
Související informace
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Molekulární struktura:
Molecular Formula:C18H18N4O6
Molecular Weight: 386.36
CAS Registry Number:6528-34-3
Manufacturing Methods : 4-Methoxy-2-nitrobenzenamine diazotization, and N-(2-methoxyphenyl)-3-oxobutanamide coupling.
Properties and Applications:brilliant red light yellow. Red powder. Sunlight fastness is better. Resistance to Cellosole, kerosene, is not able to bear or endure xylene, acid-proof alkaline better. In oily medium, especially in latex coating in use, also can be used for coating, rubber, cultural and educational supplies coloring.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Synonyma
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Vypočítané vlastnosti
| Název vlastnosti | Hodnota majetku |
| Molekulární váha | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Počet dárců vodíkového dluhopisu | 1 |
| Počet akceptorů vodíkové vazby | 8 |
| Otočný počet dluhopisů | 7 |
| Přesná hmotnost | 386.12263431 Da |
| Monoizotopická hmota | 386.12263431 Da |
| Topologická oblast polárního povrchu | 135 Ų |
| Počet těžkých atomů | 28 |
| Formální obvinění | 0 |
| Složitost | 593 |
| Počet atomů izotopů | 0 |
| Definovaný počet atomových stereocenter | 0 |
| Nedefinovaný počet atomových stereocenter | 1 |
| Počet definovaných stereocenter Bond | 0 |
| Nedefinovaný počet stereocenter Bond | 0 |
| Počet jednotek kovalentní vazby | 1 |
| Sloučenina je kanonizována | Ano |











